(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) - Names and Identifiers
Name | (2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT)
|
Synonyms | propan-2-amine (S) -2-hydroxy-2-phenylacetate -N-Benzyl-1-(4-methoxyphenyl) (2S)-Hydroxy(phenyl)acetic acid 6-methoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-2-ium-7-ol R-(N-benzyl-2-amino)-1-(4-methoxyphenyl) propane (S)-mandelic acid salt (2R)-N-benzyl-1-(4-methoxyphenyl)propan-2-aminium (2S)-hydroxy(phenyl)ethanoate (2S)-Hydroxy(phenyl)acetic acid (2R)-N-benzyl-1-(4-methoxyphenyl)propan-2-amine
|
CAS | 188690-84-8
|
InChI | InChI=1/C17H21NO.C8H8O3/c1-14(18-13-16-6-4-3-5-7-16)12-15-8-10-17(19-2)11-9-15;9-7(8(10)11)6-4-2-1-3-5-6/h3-11,14,18H,12-13H2,1-2H3;1-5,7,9H,(H,10,11)/t14-;7-/m10/s1 |
(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) - Physico-chemical Properties
Molecular Formula | C17H21NO.C8H8O3
|
Molar Mass | 407.507 |
Boling Point | 592.1°C at 760 mmHg |
Flash Point | 311.9°C |
Vapor Presure | 7.22E-15mmHg at 25°C |
Storage Condition | 2-8°C |
(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) - Introduction
(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) is an organic compound. Its properties are as follows:
1. Appearance: colorless crystals or white crystalline powder;
2. Solubility: soluble in water, ethanol and ether and other organic solvents;
3. Melting Point: about 120-125 degrees Celsius.
This compound is commonly used as a pharmaceutical intermediate and synthetic reagent. Its applications in the medical field include the synthesis of anticancer drugs and the preparation of hypnotic drugs. In addition, it can also be used for carboxylic acid protecting groups in organic synthesis reactions.
The method of preparing the compound is mainly through the method of organic synthetic chemistry, using the corresponding substrates and reagents for a series of reactions, after esterification, steps such as amination and hydrochloric acid salification give the target product.
Regarding safety information, the compound is relatively stable under normal conditions of use, but the following safety precautions still need to be paid attention:
1. Contact with eyes, skin and respiratory tract should be avoided. Wear suitable protective gloves, masks and goggles during operation;
2. Avoid reaction with strong oxidant and high temperature to prevent dangerous accidents;
3. Must be stored in a dry, dark and well-ventilated place, away from open flames and heat sources;
4. Waste should be disposed of properly and comply with local environmental regulations.
In addition, any use and handling of the compound should be directed by qualified and knowledgeable personnel.
Last Update:2024-04-09 20:52:54